C17H22ClNO2 — CID 176710202
(3R)-3-(3-chloro-4-pentan-3-ylphenyl)-3-methylpiperidine-2,6-dione (PubChem CID 176710202) has the molecular formula C17H22ClNO2 and a molecular weight of 307.82 g/mol. Its IUPAC name is (3R)-3-(3-chloro-4-pentan-3-ylphenyl)-3-methylpiperidine-2,6-dione.
| Compound Name | (3R)-3-(3-chloro-4-pentan-3-ylphenyl)-3-methylpiperidine-2,6-dione |
|---|---|
| PubChem CID | 176710202 |
| Molecular Formula | C17H22ClNO2 |
| Molecular Weight | 307.82 g/mol |
| Exact Mass | 307.13 |
| IUPAC Name | (3R)-3-(3-chloro-4-pentan-3-ylphenyl)-3-methylpiperidine-2,6-dione |
| SMILES | CCC(CC)c1ccc([C@@]2(C)CCC(=O)NC2=O)cc1Cl |
| InChI | InChI=1S/C17H22ClNO2/c1-4-11(5-2)13-7-6-12(10-14(13)18)17(3)9-8-15(20)19-16(17)21/h6-7,10-11H,4-5,8-9H2,1-3H3,(H,19,20,21)/t17-/m1/s1 |
| InChIKey | GLJIBGXGQKFHPY-QGZVFWFLSA-N |
| XLogP | 3.94 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.82 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|