C17H20N2O — CID 177061566
2-[3,4-bis(methylideneamino)phenyl]-2-prop-2-enylcyclohexan-1-one (PubChem CID 177061566) has the molecular formula C17H20N2O and a molecular weight of 268.36 g/mol. Its IUPAC name is 2-[3,4-bis(methylideneamino)phenyl]-2-prop-2-enylcyclohexan-1-one.
| Compound Name | 2-[3,4-bis(methylideneamino)phenyl]-2-prop-2-enylcyclohexan-1-one |
|---|---|
| PubChem CID | 177061566 |
| Molecular Formula | C17H20N2O |
| Molecular Weight | 268.36 g/mol |
| Exact Mass | 268.16 |
| IUPAC Name | 2-[3,4-bis(methylideneamino)phenyl]-2-prop-2-enylcyclohexan-1-one |
| SMILES | C=CCC1(c2ccc(N=C)c(N=C)c2)CCCCC1=O |
| InChI | InChI=1S/C17H20N2O/c1-4-10-17(11-6-5-7-16(17)20)13-8-9-14(18-2)15(12-13)19-3/h4,8-9,12H,1-3,5-7,10-11H2 |
| InChIKey | YFICRHMFRUFPKO-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 41.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.36 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|