C21H25N2O2+ — CID 4073534
3-ethyl-3-[4-(2,4,6-trimethylpyridin-1-ium-1-yl)phenyl]piperidine-2,6-dione (PubChem CID 4073534) has the molecular formula C21H25N2O2+ and a molecular weight of 337.44 g/mol. Its IUPAC name is 3-ethyl-3-[4-(2,4,6-trimethylpyridin-1-ium-1-yl)phenyl]piperidine-2,6-dione.
| Compound Name | 3-ethyl-3-[4-(2,4,6-trimethylpyridin-1-ium-1-yl)phenyl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 4073534 |
| Molecular Formula | C21H25N2O2+ |
| Molecular Weight | 337.44 g/mol |
| Exact Mass | 337.19 |
| IUPAC Name | 3-ethyl-3-[4-(2,4,6-trimethylpyridin-1-ium-1-yl)phenyl]piperidine-2,6-dione |
| SMILES | CCC1(c2ccc(-[n+]3c(C)cc(C)cc3C)cc2)CCC(=O)NC1=O |
| InChI | InChI=1S/C21H24N2O2/c1-5-21(11-10-19(24)22-20(21)25)17-6-8-18(9-7-17)23-15(3)12-14(2)13-16(23)4/h6-9,12-13H,5,10-11H2,1-4H3/p+1 |
| InChIKey | GQUDCTVSRRIFII-UHFFFAOYSA-O |
| XLogP | 2.97 |
| TPSA | 50.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.44 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|