C20H22N2O4S — CID 40517909
N-[4-[(3S)-3-ethyl-2,6-dioxopiperidin-3-yl]phenyl]-4-methylbenzenesulfonamide (PubChem CID 40517909) has the molecular formula C20H22N2O4S and a molecular weight of 386.47 g/mol. Its IUPAC name is N-[4-[(3S)-3-ethyl-2,6-dioxopiperidin-3-yl]phenyl]-4-methylbenzenesulfonamide.
| Compound Name | N-[4-[(3S)-3-ethyl-2,6-dioxopiperidin-3-yl]phenyl]-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 40517909 |
| Molecular Formula | C20H22N2O4S |
| Molecular Weight | 386.47 g/mol |
| Exact Mass | 386.13 |
| IUPAC Name | N-[4-[(3S)-3-ethyl-2,6-dioxopiperidin-3-yl]phenyl]-4-methylbenzenesulfonamide |
| SMILES | CC[C@@]1(c2ccc(NS(=O)(=O)c3ccc(C)cc3)cc2)CCC(=O)NC1=O |
| InChI | InChI=1S/C20H22N2O4S/c1-3-20(13-12-18(23)21-19(20)24)15-6-8-16(9-7-15)22-27(25,26)17-10-4-14(2)5-11-17/h4-11,22H,3,12-13H2,1-2H3,(H,21,23,24)/t20-/m0/s1 |
| InChIKey | YRKCRRKPTRXVJQ-FQEVSTJZSA-N |
| XLogP | 2.88 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.47 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|