C17H17ClN2O4S2 — CID 94664231
5-chloro-N-[4-[(3S)-3-ethyl-2,6-dioxopiperidin-3-yl]phenyl]thiophene-2-sulfonamide (PubChem CID 94664231) has the molecular formula C17H17ClN2O4S2 and a molecular weight of 412.92 g/mol. Its IUPAC name is 5-chloro-N-[4-[(3S)-3-ethyl-2,6-dioxopiperidin-3-yl]phenyl]thiophene-2-sulfonamide.
| Compound Name | 5-chloro-N-[4-[(3S)-3-ethyl-2,6-dioxopiperidin-3-yl]phenyl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 94664231 |
| Molecular Formula | C17H17ClN2O4S2 |
| Molecular Weight | 412.92 g/mol |
| Exact Mass | 412.03 |
| IUPAC Name | 5-chloro-N-[4-[(3S)-3-ethyl-2,6-dioxopiperidin-3-yl]phenyl]thiophene-2-sulfonamide |
| SMILES | CC[C@@]1(c2ccc(NS(=O)(=O)c3ccc(Cl)s3)cc2)CCC(=O)NC1=O |
| InChI | InChI=1S/C17H17ClN2O4S2/c1-2-17(10-9-14(21)19-16(17)22)11-3-5-12(6-4-11)20-26(23,24)15-8-7-13(18)25-15/h3-8,20H,2,9-10H2,1H3,(H,19,21,22)/t17-/m0/s1 |
| InChIKey | ZBKOGBIXFKCFRG-KRWDZBQOSA-N |
| XLogP | 3.29 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.92 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|