C20H20N2O6S — CID 10811829
2-[[4-(3-ethyl-2,6-dioxopiperidin-3-yl)phenyl]sulfamoyl]benzoic acid (PubChem CID 10811829) has the molecular formula C20H20N2O6S and a molecular weight of 416.46 g/mol. Its IUPAC name is 2-[[4-(3-ethyl-2,6-dioxopiperidin-3-yl)phenyl]sulfamoyl]benzoic acid.
| Compound Name | 2-[[4-(3-ethyl-2,6-dioxopiperidin-3-yl)phenyl]sulfamoyl]benzoic acid |
|---|---|
| PubChem CID | 10811829 |
| Molecular Formula | C20H20N2O6S |
| Molecular Weight | 416.46 g/mol |
| Exact Mass | 416.10 |
| IUPAC Name | 2-[[4-(3-ethyl-2,6-dioxopiperidin-3-yl)phenyl]sulfamoyl]benzoic acid |
| SMILES | CCC1(c2ccc(NS(=O)(=O)c3ccccc3C(=O)O)cc2)CCC(=O)NC1=O |
| InChI | InChI=1S/C20H20N2O6S/c1-2-20(12-11-17(23)21-19(20)26)13-7-9-14(10-8-13)22-29(27,28)16-6-4-3-5-15(16)18(24)25/h3-10,22H,2,11-12H2,1H3,(H,24,25)(H,21,23,26) |
| InChIKey | QIPUIOGTPLYXEC-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 129.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.46 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|