C23H33N5O4 — CID 29112462
N'-[4-[(3R)-3-ethyl-2,6-dioxopiperidin-3-yl]phenyl]-N-[3-(4-methylpiperazin-1-yl)propyl]oxamide (PubChem CID 29112462) has the molecular formula C23H33N5O4 and a molecular weight of 443.55 g/mol. Its IUPAC name is N'-[4-[(3R)-3-ethyl-2,6-dioxopiperidin-3-yl]phenyl]-N-[3-(4-methylpiperazin-1-yl)propyl]oxamide.
| Compound Name | N'-[4-[(3R)-3-ethyl-2,6-dioxopiperidin-3-yl]phenyl]-N-[3-(4-methylpiperazin-1-yl)propyl]oxamide |
|---|---|
| PubChem CID | 29112462 |
| Molecular Formula | C23H33N5O4 |
| Molecular Weight | 443.55 g/mol |
| Exact Mass | 443.25 |
| IUPAC Name | N'-[4-[(3R)-3-ethyl-2,6-dioxopiperidin-3-yl]phenyl]-N-[3-(4-methylpiperazin-1-yl)propyl]oxamide |
| SMILES | CC[C@]1(c2ccc(NC(=O)C(=O)NCCCN3CCN(C)CC3)cc2)CCC(=O)NC1=O |
| InChI | InChI=1S/C23H33N5O4/c1-3-23(10-9-19(29)26-22(23)32)17-5-7-18(8-6-17)25-21(31)20(30)24-11-4-12-28-15-13-27(2)14-16-28/h5-8H,3-4,9-16H2,1-2H3,(H,24,30)(H,25,31)(H,26,29,32)/t23-/m1/s1 |
| InChIKey | LZQNDXURPARGDY-HSZRJFAPSA-N |
| XLogP | 0.46 |
| TPSA | 110.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.55 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|