About 5-chloro-N-(3,3-dimethyl-2-oxo-1H-indol-5-yl)thiophene-2-sulfonamide
5-chloro-N-(3,3-dimethyl-2-oxo-1H-indol-5-yl)thiophene-2-sulfonamide (PubChem CID 110405814) has the molecular formula C14H13ClN2O3S2
and a molecular weight of 356.86 g/mol. Its IUPAC name is 5-chloro-N-(3,3-dimethyl-2-oxo-1H-indol-5-yl)thiophene-2-sulfonamide.
Molecular Properties
| Compound Name | 5-chloro-N-(3,3-dimethyl-2-oxo-1H-indol-5-yl)thiophene-2-sulfonamide |
| PubChem CID | 110405814 |
| Molecular Formula | C14H13ClN2O3S2 |
| Molecular Weight | 356.86 g/mol |
| Exact Mass | 356.01 |
| IUPAC Name | 5-chloro-N-(3,3-dimethyl-2-oxo-1H-indol-5-yl)thiophene-2-sulfonamide |
| SMILES | CC1(C)C(=O)Nc2ccc(NS(=O)(=O)c3ccc(Cl)s3)cc21 |
| InChI | InChI=1S/C14H13ClN2O3S2/c1-14(2)9-7-8(3-4-10(9)16-13(14)18)17-22(19,20)12-6-5-11(15)21-12/h3-7,17H,1-2H3,(H,16,18) |
| InChIKey | ZRMSBNATNJPMGW-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 356.86 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-chloro-N-(3,3-dimethyl-2-oxo-1H-indol-5-yl)thiophene-2-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-chloro-N-(3,3-dimethyl-2-oxo-1H-indol-5-yl)thiophene-2-sulfonamide?
The IUPAC name of 5-chloro-N-(3,3-dimethyl-2-oxo-1H-indol-5-yl)thiophene-2-sulfonamide (CID 110405814) is 5-chloro-N-(3,3-dimethyl-2-oxo-1H-indol-5-yl)thiophene-2-sulfonamide.
What is the SMILES notation for 5-chloro-N-(3,3-dimethyl-2-oxo-1H-indol-5-yl)thiophene-2-sulfonamide?
The canonical SMILES for 5-chloro-N-(3,3-dimethyl-2-oxo-1H-indol-5-yl)thiophene-2-sulfonamide is CC1(C)C(=O)Nc2ccc(NS(=O)(=O)c3ccc(Cl)s3)cc21.
What is the InChIKey of 5-chloro-N-(3,3-dimethyl-2-oxo-1H-indol-5-yl)thiophene-2-sulfonamide?
The InChIKey is ZRMSBNATNJPMGW-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H13ClN2O3S2/c1-14(2)9-7-8(3-4-10(9)16-13(14)18)17-22(19,20)12-6-5-11(15)21-12/h3-7,17H,1-2H3,(H,16,18).
What are the key properties of 5-chloro-N-(3,3-dimethyl-2-oxo-1H-indol-5-yl)thiophene-2-sulfonamide?
5-chloro-N-(3,3-dimethyl-2-oxo-1H-indol-5-yl)thiophene-2-sulfonamide has a molecular weight of 356.86 g/mol, XLogP of 3.43, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-chloro-N-(3,3-dimethyl-2-oxo-1H-indol-5-yl)thiophene-2-sulfonamide is sourced from PubChem (CID 110405814), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).