C16H17ClN2O2S2 — CID 59375183
5-chloro-N-(2,2,4-trimethyl-1H-quinolin-6-yl)thiophene-2-sulfonamide (PubChem CID 59375183) has the molecular formula C16H17ClN2O2S2 and a molecular weight of 368.91 g/mol. Its IUPAC name is 5-chloro-N-(2,2,4-trimethyl-1H-quinolin-6-yl)thiophene-2-sulfonamide.
| Compound Name | 5-chloro-N-(2,2,4-trimethyl-1H-quinolin-6-yl)thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 59375183 |
| Molecular Formula | C16H17ClN2O2S2 |
| Molecular Weight | 368.91 g/mol |
| Exact Mass | 368.04 |
| IUPAC Name | 5-chloro-N-(2,2,4-trimethyl-1H-quinolin-6-yl)thiophene-2-sulfonamide |
| SMILES | CC1=CC(C)(C)Nc2ccc(NS(=O)(=O)c3ccc(Cl)s3)cc21 |
| InChI | InChI=1S/C16H17ClN2O2S2/c1-10-9-16(2,3)18-13-5-4-11(8-12(10)13)19-23(20,21)15-7-6-14(17)22-15/h4-9,18-19H,1-3H3 |
| InChIKey | VTQLUECIOXXDIR-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.91 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |