C16H16N2O3S2 — CID 110405666
N-(2-oxospiro[1H-indole-3,1'-cyclopentane]-5-yl)thiophene-2-sulfonamide (PubChem CID 110405666) has the molecular formula C16H16N2O3S2 and a molecular weight of 348.45 g/mol. Its IUPAC name is N-(2-oxospiro[1H-indole-3,1'-cyclopentane]-5-yl)thiophene-2-sulfonamide.
| Compound Name | N-(2-oxospiro[1H-indole-3,1'-cyclopentane]-5-yl)thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 110405666 |
| Molecular Formula | C16H16N2O3S2 |
| Molecular Weight | 348.45 g/mol |
| Exact Mass | 348.06 |
| IUPAC Name | N-(2-oxospiro[1H-indole-3,1'-cyclopentane]-5-yl)thiophene-2-sulfonamide |
| SMILES | O=C1Nc2ccc(NS(=O)(=O)c3cccs3)cc2C12CCCC2 |
| InChI | InChI=1S/C16H16N2O3S2/c19-15-16(7-1-2-8-16)12-10-11(5-6-13(12)17-15)18-23(20,21)14-4-3-9-22-14/h3-6,9-10,18H,1-2,7-8H2,(H,17,19) |
| InChIKey | WOFSBBISWUURCW-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.45 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |