C20H17N3O3S — CID 118169114
N-(2-oxospiro[1H-indole-3,1'-cyclobutane]-5-yl)quinoline-8-sulfonamide (PubChem CID 118169114) has the molecular formula C20H17N3O3S and a molecular weight of 379.44 g/mol. Its IUPAC name is N-(2-oxospiro[1H-indole-3,1'-cyclobutane]-5-yl)quinoline-8-sulfonamide.
| Compound Name | N-(2-oxospiro[1H-indole-3,1'-cyclobutane]-5-yl)quinoline-8-sulfonamide |
|---|---|
| PubChem CID | 118169114 |
| Molecular Formula | C20H17N3O3S |
| Molecular Weight | 379.44 g/mol |
| Exact Mass | 379.10 |
| IUPAC Name | N-(2-oxospiro[1H-indole-3,1'-cyclobutane]-5-yl)quinoline-8-sulfonamide |
| SMILES | O=C1Nc2ccc(NS(=O)(=O)c3cccc4cccnc34)cc2C12CCC2 |
| InChI | InChI=1S/C20H17N3O3S/c24-19-20(9-3-10-20)15-12-14(7-8-16(15)22-19)23-27(25,26)17-6-1-4-13-5-2-11-21-18(13)17/h1-2,4-8,11-12,23H,3,9-10H2,(H,22,24) |
| InChIKey | NZQURRFZEYHLAP-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 88.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.44 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |