C20H19Cl2NO2 — CID 102495292
4-benzyl-2-(3,4-dichlorophenyl)-2-prop-2-enylmorpholin-3-one (PubChem CID 102495292) has the molecular formula C20H19Cl2NO2 and a molecular weight of 376.28 g/mol. Its IUPAC name is 4-benzyl-2-(3,4-dichlorophenyl)-2-prop-2-enylmorpholin-3-one.
| Compound Name | 4-benzyl-2-(3,4-dichlorophenyl)-2-prop-2-enylmorpholin-3-one |
|---|---|
| PubChem CID | 102495292 |
| Molecular Formula | C20H19Cl2NO2 |
| Molecular Weight | 376.28 g/mol |
| Exact Mass | 375.08 |
| IUPAC Name | 4-benzyl-2-(3,4-dichlorophenyl)-2-prop-2-enylmorpholin-3-one |
| SMILES | C=CCC1(c2ccc(Cl)c(Cl)c2)OCCN(Cc2ccccc2)C1=O |
| InChI | InChI=1S/C20H19Cl2NO2/c1-2-10-20(16-8-9-17(21)18(22)13-16)19(24)23(11-12-25-20)14-15-6-4-3-5-7-15/h2-9,13H,1,10-12,14H2 |
| InChIKey | HFNBNWQXLNNATA-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.28 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|