C17H21Cl2NO — CID 66837651
(3aR,5R)-5-(cyclopropylmethoxy)-3a-(3,4-dichlorophenyl)-2,3,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole (PubChem CID 66837651) has the molecular formula C17H21Cl2NO and a molecular weight of 326.27 g/mol. Its IUPAC name is (3aR,5R)-5-(cyclopropylmethoxy)-3a-(3,4-dichlorophenyl)-2,3,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole.
| Compound Name | (3aR,5R)-5-(cyclopropylmethoxy)-3a-(3,4-dichlorophenyl)-2,3,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole |
|---|---|
| PubChem CID | 66837651 |
| Molecular Formula | C17H21Cl2NO |
| Molecular Weight | 326.27 g/mol |
| Exact Mass | 325.10 |
| IUPAC Name | (3aR,5R)-5-(cyclopropylmethoxy)-3a-(3,4-dichlorophenyl)-2,3,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole |
| SMILES | Clc1ccc([C@]23CNCC2C[C@@H](OCC2CC2)C3)cc1Cl |
| InChI | InChI=1S/C17H21Cl2NO/c18-15-4-3-12(6-16(15)19)17-7-14(21-9-11-1-2-11)5-13(17)8-20-10-17/h3-4,6,11,13-14,20H,1-2,5,7-10H2/t13?,14-,17+/m1/s1 |
| InChIKey | PLVKPGPXFAELSX-ROFXEPAZSA-N |
| XLogP | 4.04 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.27 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |