C22H32Cl2O — CID 54515841
1,2-dichloro-4-[1-[4-(2-ethoxyethyl)cyclohexyl]cyclohexyl]benzene (PubChem CID 54515841) has the molecular formula C22H32Cl2O and a molecular weight of 383.40 g/mol. Its IUPAC name is 1,2-dichloro-4-[1-[4-(2-ethoxyethyl)cyclohexyl]cyclohexyl]benzene.
| Compound Name | 1,2-dichloro-4-[1-[4-(2-ethoxyethyl)cyclohexyl]cyclohexyl]benzene |
|---|---|
| PubChem CID | 54515841 |
| Molecular Formula | C22H32Cl2O |
| Molecular Weight | 383.40 g/mol |
| Exact Mass | 382.18 |
| IUPAC Name | 1,2-dichloro-4-[1-[4-(2-ethoxyethyl)cyclohexyl]cyclohexyl]benzene |
| SMILES | CCOCCC1CCC(C2(c3ccc(Cl)c(Cl)c3)CCCCC2)CC1 |
| InChI | InChI=1S/C22H32Cl2O/c1-2-25-15-12-17-6-8-18(9-7-17)22(13-4-3-5-14-22)19-10-11-20(23)21(24)16-19/h10-11,16-18H,2-9,12-15H2,1H3 |
| InChIKey | YMIQZEXPGDEKRK-UHFFFAOYSA-N |
| XLogP | 7.43 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.40 |
| LogP ≤ 5 | 7.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|