C16H21Cl2NO — CID 68746464
(7S)-7-(3,4-dichlorophenyl)-7-(2-ethoxyethyl)-3-azabicyclo[4.1.0]heptane (PubChem CID 68746464) has the molecular formula C16H21Cl2NO and a molecular weight of 314.26 g/mol. Its IUPAC name is (7S)-7-(3,4-dichlorophenyl)-7-(2-ethoxyethyl)-3-azabicyclo[4.1.0]heptane.
| Compound Name | (7S)-7-(3,4-dichlorophenyl)-7-(2-ethoxyethyl)-3-azabicyclo[4.1.0]heptane |
|---|---|
| PubChem CID | 68746464 |
| Molecular Formula | C16H21Cl2NO |
| Molecular Weight | 314.26 g/mol |
| Exact Mass | 313.10 |
| IUPAC Name | (7S)-7-(3,4-dichlorophenyl)-7-(2-ethoxyethyl)-3-azabicyclo[4.1.0]heptane |
| SMILES | CCOCC[C@]1(c2ccc(Cl)c(Cl)c2)C2CCNCC21 |
| InChI | InChI=1S/C16H21Cl2NO/c1-2-20-8-6-16(12-5-7-19-10-13(12)16)11-3-4-14(17)15(18)9-11/h3-4,9,12-13,19H,2,5-8,10H2,1H3/t12?,13?,16-/m0/s1 |
| InChIKey | COTZXSIVKGWGJD-ZUEPYMLJSA-N |
| XLogP | 3.90 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.26 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|