C7H13F3N2O3S — CID 174935061
(4R)-4-amino-5-oxo-5-(2,2,2-trifluoroethylamino)pentane-1-sulfinic acid (PubChem CID 174935061) has the molecular formula C7H13F3N2O3S and a molecular weight of 262.25 g/mol. Its IUPAC name is (4R)-4-amino-5-oxo-5-(2,2,2-trifluoroethylamino)pentane-1-sulfinic acid.
| Compound Name | (4R)-4-amino-5-oxo-5-(2,2,2-trifluoroethylamino)pentane-1-sulfinic acid |
|---|---|
| PubChem CID | 174935061 |
| Molecular Formula | C7H13F3N2O3S |
| Molecular Weight | 262.25 g/mol |
| Exact Mass | 262.06 |
| IUPAC Name | (4R)-4-amino-5-oxo-5-(2,2,2-trifluoroethylamino)pentane-1-sulfinic acid |
| SMILES | N[C@H](CCCS(=O)O)C(=O)NCC(F)(F)F |
| InChI | InChI=1S/C7H13F3N2O3S/c8-7(9,10)4-12-6(13)5(11)2-1-3-16(14)15/h5H,1-4,11H2,(H,12,13)(H,14,15)/t5-/m1/s1 |
| InChIKey | BNJRNXCTGDZSCA-RXMQYKEDSA-N |
| XLogP | -0.01 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.25 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|