About hydron;iodobenzene;hexafluorophosphate
hydron;iodobenzene;hexafluorophosphate (PubChem CID 174937039) has the molecular formula C6H6F6IP
and a molecular weight of 349.98 g/mol. Its IUPAC name is hydron;iodobenzene;hexafluorophosphate.
Molecular Properties
| Compound Name | hydron;iodobenzene;hexafluorophosphate |
| PubChem CID | 174937039 |
| Molecular Formula | C6H6F6IP |
| Molecular Weight | 349.98 g/mol |
| Exact Mass | 349.92 |
| IUPAC Name | hydron;iodobenzene;hexafluorophosphate |
| SMILES | F[P-](F)(F)(F)(F)F.Ic1ccccc1.[H+] |
| InChI | InChI=1S/C6H5I.F6P/c7-6-4-2-1-3-5-6;1-7(2,3,4,5)6/h1-5H;/q;-1/p+1 |
| InChIKey | FZDJENWPPJMJLV-UHFFFAOYSA-O |
| XLogP | 5.79 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 349.98 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze hydron;iodobenzene;hexafluorophosphate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hydron;iodobenzene;hexafluorophosphate?
The IUPAC name of hydron;iodobenzene;hexafluorophosphate (CID 174937039) is hydron;iodobenzene;hexafluorophosphate.
What is the SMILES notation for hydron;iodobenzene;hexafluorophosphate?
The canonical SMILES for hydron;iodobenzene;hexafluorophosphate is F[P-](F)(F)(F)(F)F.Ic1ccccc1.[H+].
What is the InChIKey of hydron;iodobenzene;hexafluorophosphate?
The InChIKey is FZDJENWPPJMJLV-UHFFFAOYSA-O. The full InChI is InChI=1S/C6H5I.F6P/c7-6-4-2-1-3-5-6;1-7(2,3,4,5)6/h1-5H;/q;-1/p+1.
What are the key properties of hydron;iodobenzene;hexafluorophosphate?
hydron;iodobenzene;hexafluorophosphate has a molecular weight of 349.98 g/mol, XLogP of 5.79, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for hydron;iodobenzene;hexafluorophosphate is sourced from PubChem (CID 174937039), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).