About methylsulfinylmethane;prop-2-enyl benzenesulfonate
methylsulfinylmethane;prop-2-enyl benzenesulfonate (PubChem CID 174938509) has the molecular formula C11H16O4S2
and a molecular weight of 276.38 g/mol. Its IUPAC name is methylsulfinylmethane;prop-2-enyl benzenesulfonate.
Molecular Properties
| Compound Name | methylsulfinylmethane;prop-2-enyl benzenesulfonate |
| PubChem CID | 174938509 |
| Molecular Formula | C11H16O4S2 |
| Molecular Weight | 276.38 g/mol |
| Exact Mass | 276.05 |
| IUPAC Name | methylsulfinylmethane;prop-2-enyl benzenesulfonate |
| SMILES | C=CCOS(=O)(=O)c1ccccc1.CS(C)=O |
| InChI | InChI=1S/C9H10O3S.C2H6OS/c1-2-8-12-13(10,11)9-6-4-3-5-7-9;1-4(2)3/h2-7H,1,8H2;1-2H3 |
| InChIKey | IITZGFVYLQVRNC-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 276.38 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze methylsulfinylmethane;prop-2-enyl benzenesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methylsulfinylmethane;prop-2-enyl benzenesulfonate?
The IUPAC name of methylsulfinylmethane;prop-2-enyl benzenesulfonate (CID 174938509) is methylsulfinylmethane;prop-2-enyl benzenesulfonate.
What is the SMILES notation for methylsulfinylmethane;prop-2-enyl benzenesulfonate?
The canonical SMILES for methylsulfinylmethane;prop-2-enyl benzenesulfonate is C=CCOS(=O)(=O)c1ccccc1.CS(C)=O.
What is the InChIKey of methylsulfinylmethane;prop-2-enyl benzenesulfonate?
The InChIKey is IITZGFVYLQVRNC-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10O3S.C2H6OS/c1-2-8-12-13(10,11)9-6-4-3-5-7-9;1-4(2)3/h2-7H,1,8H2;1-2H3.
What are the key properties of methylsulfinylmethane;prop-2-enyl benzenesulfonate?
methylsulfinylmethane;prop-2-enyl benzenesulfonate has a molecular weight of 276.38 g/mol, XLogP of 1.57, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methylsulfinylmethane;prop-2-enyl benzenesulfonate is sourced from PubChem (CID 174938509), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).