About bis(sulfanylidene)molybdenum;prop-2-en-1-amine;prop-2-enyl benzenesulfonate
bis(sulfanylidene)molybdenum;prop-2-en-1-amine;prop-2-enyl benzenesulfonate (PubChem CID 175506688) has the molecular formula C12H17MoNO3S3
and a molecular weight of 415.41 g/mol. Its IUPAC name is bis(sulfanylidene)molybdenum;prop-2-en-1-amine;prop-2-enyl benzenesulfonate.
Molecular Properties
| Compound Name | bis(sulfanylidene)molybdenum;prop-2-en-1-amine;prop-2-enyl benzenesulfonate |
| PubChem CID | 175506688 |
| Molecular Formula | C12H17MoNO3S3 |
| Molecular Weight | 415.41 g/mol |
| Exact Mass | 416.94 |
| IUPAC Name | bis(sulfanylidene)molybdenum;prop-2-en-1-amine;prop-2-enyl benzenesulfonate |
| SMILES | C=CCN.C=CCOS(=O)(=O)c1ccccc1.S=[Mo]=S |
| InChI | InChI=1S/C9H10O3S.C3H7N.Mo.2S/c1-2-8-12-13(10,11)9-6-4-3-5-7-9;1-2-3-4;;;/h2-7H,1,8H2;2H,1,3-4H2;;; |
| InChIKey | BTRCDRMRTOPXDU-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 415.41 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze bis(sulfanylidene)molybdenum;prop-2-en-1-amine;prop-2-enyl benzenesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(sulfanylidene)molybdenum;prop-2-en-1-amine;prop-2-enyl benzenesulfonate?
The IUPAC name of bis(sulfanylidene)molybdenum;prop-2-en-1-amine;prop-2-enyl benzenesulfonate (CID 175506688) is bis(sulfanylidene)molybdenum;prop-2-en-1-amine;prop-2-enyl benzenesulfonate.
What is the SMILES notation for bis(sulfanylidene)molybdenum;prop-2-en-1-amine;prop-2-enyl benzenesulfonate?
The canonical SMILES for bis(sulfanylidene)molybdenum;prop-2-en-1-amine;prop-2-enyl benzenesulfonate is C=CCN.C=CCOS(=O)(=O)c1ccccc1.S=[Mo]=S.
What is the InChIKey of bis(sulfanylidene)molybdenum;prop-2-en-1-amine;prop-2-enyl benzenesulfonate?
The InChIKey is BTRCDRMRTOPXDU-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10O3S.C3H7N.Mo.2S/c1-2-8-12-13(10,11)9-6-4-3-5-7-9;1-2-3-4;;;/h2-7H,1,8H2;2H,1,3-4H2;;;.
What are the key properties of bis(sulfanylidene)molybdenum;prop-2-en-1-amine;prop-2-enyl benzenesulfonate?
bis(sulfanylidene)molybdenum;prop-2-en-1-amine;prop-2-enyl benzenesulfonate has a molecular weight of 415.41 g/mol, XLogP of 3.00, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for bis(sulfanylidene)molybdenum;prop-2-en-1-amine;prop-2-enyl benzenesulfonate is sourced from PubChem (CID 175506688), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).