C16H24N2O3 — CID 174939307
(3-methyl-5-morpholin-4-ylphenyl) N-tert-butylcarbamate (PubChem CID 174939307) has the molecular formula C16H24N2O3 and a molecular weight of 292.38 g/mol. Its IUPAC name is (3-methyl-5-morpholin-4-ylphenyl) N-tert-butylcarbamate.
| Compound Name | (3-methyl-5-morpholin-4-ylphenyl) N-tert-butylcarbamate |
|---|---|
| PubChem CID | 174939307 |
| Molecular Formula | C16H24N2O3 |
| Molecular Weight | 292.38 g/mol |
| Exact Mass | 292.18 |
| IUPAC Name | (3-methyl-5-morpholin-4-ylphenyl) N-tert-butylcarbamate |
| SMILES | Cc1cc(OC(=O)NC(C)(C)C)cc(N2CCOCC2)c1 |
| InChI | InChI=1S/C16H24N2O3/c1-12-9-13(18-5-7-20-8-6-18)11-14(10-12)21-15(19)17-16(2,3)4/h9-11H,5-8H2,1-4H3,(H,17,19) |
| InChIKey | KFSJLNQEQIGNCP-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.38 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |