C18H26N2O5 — CID 162025250
tert-butyl N-methyl-N-(3-methyl-5-morpholin-4-ylphenyl)carbamate;carbon dioxide (PubChem CID 162025250) has the molecular formula C18H26N2O5 and a molecular weight of 350.42 g/mol. Its IUPAC name is tert-butyl N-methyl-N-(3-methyl-5-morpholin-4-ylphenyl)carbamate;carbon dioxide.
| Compound Name | tert-butyl N-methyl-N-(3-methyl-5-morpholin-4-ylphenyl)carbamate;carbon dioxide |
|---|---|
| PubChem CID | 162025250 |
| Molecular Formula | C18H26N2O5 |
| Molecular Weight | 350.42 g/mol |
| Exact Mass | 350.18 |
| IUPAC Name | tert-butyl N-methyl-N-(3-methyl-5-morpholin-4-ylphenyl)carbamate;carbon dioxide |
| SMILES | Cc1cc(N2CCOCC2)cc(N(C)C(=O)OC(C)(C)C)c1.O=C=O |
| InChI | InChI=1S/C17H26N2O3.CO2/c1-13-10-14(18(5)16(20)22-17(2,3)4)12-15(11-13)19-6-8-21-9-7-19;2-1-3/h10-12H,6-9H2,1-5H3; |
| InChIKey | YVHASXHKHXXJRQ-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 76.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.42 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |