C20H26N2O5 — CID 67985208
methyl 3-[(2-methylpropan-2-yl)oxycarbonyl-[(4-morpholin-4-ylphenyl)methyl]amino]prop-2-ynoate (PubChem CID 67985208) has the molecular formula C20H26N2O5 and a molecular weight of 374.44 g/mol. Its IUPAC name is methyl 3-[(2-methylpropan-2-yl)oxycarbonyl-[(4-morpholin-4-ylphenyl)methyl]amino]prop-2-ynoate.
| Compound Name | methyl 3-[(2-methylpropan-2-yl)oxycarbonyl-[(4-morpholin-4-ylphenyl)methyl]amino]prop-2-ynoate |
|---|---|
| PubChem CID | 67985208 |
| Molecular Formula | C20H26N2O5 |
| Molecular Weight | 374.44 g/mol |
| Exact Mass | 374.18 |
| IUPAC Name | methyl 3-[(2-methylpropan-2-yl)oxycarbonyl-[(4-morpholin-4-ylphenyl)methyl]amino]prop-2-ynoate |
| SMILES | COC(=O)C#CN(Cc1ccc(N2CCOCC2)cc1)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C20H26N2O5/c1-20(2,3)27-19(24)22(10-9-18(23)25-4)15-16-5-7-17(8-6-16)21-11-13-26-14-12-21/h5-8H,11-15H2,1-4H3 |
| InChIKey | XXOADDWORRUMCH-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 68.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.44 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|