C16H21Cl2N3O4 — CID 175335320
methyl (2S)-2-acetamido-2-(2,6-dichloro-4-morpholin-4-ylanilino)propanoate (PubChem CID 175335320) has the molecular formula C16H21Cl2N3O4 and a molecular weight of 390.27 g/mol. Its IUPAC name is methyl (2S)-2-acetamido-2-(2,6-dichloro-4-morpholin-4-ylanilino)propanoate.
| Compound Name | methyl (2S)-2-acetamido-2-(2,6-dichloro-4-morpholin-4-ylanilino)propanoate |
|---|---|
| PubChem CID | 175335320 |
| Molecular Formula | C16H21Cl2N3O4 |
| Molecular Weight | 390.27 g/mol |
| Exact Mass | 389.09 |
| IUPAC Name | methyl (2S)-2-acetamido-2-(2,6-dichloro-4-morpholin-4-ylanilino)propanoate |
| SMILES | COC(=O)[C@](C)(NC(C)=O)Nc1c(Cl)cc(N2CCOCC2)cc1Cl |
| InChI | InChI=1S/C16H21Cl2N3O4/c1-10(22)19-16(2,15(23)24-3)20-14-12(17)8-11(9-13(14)18)21-4-6-25-7-5-21/h8-9,20H,4-7H2,1-3H3,(H,19,22)/t16-/m1/s1 |
| InChIKey | HDOKEIOPRDBQSX-MRXNPFEDSA-N |
| XLogP | 2.27 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.27 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|