C12H22N6O — CID 174939500
4-[(2-methylhydrazinyl)methyl]-N-propan-2-ylbenzamide;triazene (PubChem CID 174939500) has the molecular formula C12H22N6O and a molecular weight of 266.35 g/mol. Its IUPAC name is 4-[(2-methylhydrazinyl)methyl]-N-propan-2-ylbenzamide;triazene.
| Compound Name | 4-[(2-methylhydrazinyl)methyl]-N-propan-2-ylbenzamide;triazene |
|---|---|
| PubChem CID | 174939500 |
| Molecular Formula | C12H22N6O |
| Molecular Weight | 266.35 g/mol |
| Exact Mass | 266.19 |
| IUPAC Name | 4-[(2-methylhydrazinyl)methyl]-N-propan-2-ylbenzamide;triazene |
| SMILES | CNNCc1ccc(C(=O)NC(C)C)cc1.[H]/N=N/N |
| InChI | InChI=1S/C12H19N3O.H3N3/c1-9(2)15-12(16)11-6-4-10(5-7-11)8-14-13-3;1-3-2/h4-7,9,13-14H,8H2,1-3H3,(H,15,16);(H3,1,2) |
| InChIKey | LKJOIWVBENNNPD-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 115.39 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.35 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|