C21H35ClN6O3 — CID 87601837
1-(2-chloroethyl)-3-cyclohexyl-1-nitrosourea;4-[(2-methylhydrazinyl)methyl]-N-propan-2-ylbenzamide (PubChem CID 87601837) has the molecular formula C21H35ClN6O3 and a molecular weight of 455.00 g/mol. Its IUPAC name is 1-(2-chloroethyl)-3-cyclohexyl-1-nitrosourea;4-[(2-methylhydrazinyl)methyl]-N-propan-2-ylbenzamide.
| Compound Name | 1-(2-chloroethyl)-3-cyclohexyl-1-nitrosourea;4-[(2-methylhydrazinyl)methyl]-N-propan-2-ylbenzamide |
|---|---|
| PubChem CID | 87601837 |
| Molecular Formula | C21H35ClN6O3 |
| Molecular Weight | 455.00 g/mol |
| Exact Mass | 454.25 |
| IUPAC Name | 1-(2-chloroethyl)-3-cyclohexyl-1-nitrosourea;4-[(2-methylhydrazinyl)methyl]-N-propan-2-ylbenzamide |
| SMILES | CNNCc1ccc(C(=O)NC(C)C)cc1.O=NN(CCCl)C(=O)NC1CCCCC1 |
| InChI | InChI=1S/C12H19N3O.C9H16ClN3O2/c1-9(2)15-12(16)11-6-4-10(5-7-11)8-14-13-3;10-6-7-13(12-15)9(14)11-8-4-2-1-3-5-8/h4-7,9,13-14H,8H2,1-3H3,(H,15,16);8H,1-7H2,(H,11,14) |
| InChIKey | PCJQVGOWFSGIBS-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 114.93 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.00 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|