C17H23N7O — CID 174933435
4-[(2-methylhydrazinyl)methyl]-N-propan-2-ylbenzamide;7H-purine (PubChem CID 174933435) has the molecular formula C17H23N7O and a molecular weight of 341.42 g/mol. Its IUPAC name is 4-[(2-methylhydrazinyl)methyl]-N-propan-2-ylbenzamide;7H-purine.
| Compound Name | 4-[(2-methylhydrazinyl)methyl]-N-propan-2-ylbenzamide;7H-purine |
|---|---|
| PubChem CID | 174933435 |
| Molecular Formula | C17H23N7O |
| Molecular Weight | 341.42 g/mol |
| Exact Mass | 341.20 |
| IUPAC Name | 4-[(2-methylhydrazinyl)methyl]-N-propan-2-ylbenzamide;7H-purine |
| SMILES | CNNCc1ccc(C(=O)NC(C)C)cc1.c1ncc2[nH]cnc2n1 |
| InChI | InChI=1S/C12H19N3O.C5H4N4/c1-9(2)15-12(16)11-6-4-10(5-7-11)8-14-13-3;1-4-5(8-2-6-1)9-3-7-4/h4-7,9,13-14H,8H2,1-3H3,(H,15,16);1-3H,(H,6,7,8,9) |
| InChIKey | NACFUDYQKUYNGB-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 107.62 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.42 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|