C27H52N6O8 — CID 174942523
[[4,6-bis[bis(hydroxymethyl)amino]-1,3,5-triazin-2-yl]-(hydroxymethyl)amino]methanol;(Z)-octadec-9-enoic acid (PubChem CID 174942523) has the molecular formula C27H52N6O8 and a molecular weight of 588.75 g/mol. Its IUPAC name is [[4,6-bis[bis(hydroxymethyl)amino]-1,3,5-triazin-2-yl]-(hydroxymethyl)amino]methanol;(Z)-octadec-9-enoic acid.
| Compound Name | [[4,6-bis[bis(hydroxymethyl)amino]-1,3,5-triazin-2-yl]-(hydroxymethyl)amino]methanol;(Z)-octadec-9-enoic acid |
|---|---|
| PubChem CID | 174942523 |
| Molecular Formula | C27H52N6O8 |
| Molecular Weight | 588.75 g/mol |
| Exact Mass | 588.38 |
| IUPAC Name | [[4,6-bis[bis(hydroxymethyl)amino]-1,3,5-triazin-2-yl]-(hydroxymethyl)amino]methanol;(Z)-octadec-9-enoic acid |
| SMILES | CCCCCCCC/C=C\CCCCCCCC(=O)O.OCN(CO)c1nc(N(CO)CO)nc(N(CO)CO)n1 |
| InChI | InChI=1S/C18H34O2.C9H18N6O6/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20;16-1-13(2-17)7-10-8(14(3-18)4-19)12-9(11-7)15(5-20)6-21/h9-10H,2-8,11-17H2,1H3,(H,19,20);16-21H,1-6H2/b10-9-; |
| InChIKey | YZKMWJMMKNLEOD-KVVVOXFISA-N |
| XLogP | 2.10 |
| TPSA | 207.07 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 41 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.75 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|