C23H31NO2 — CID 174945032
3-[(2,4-dimethoxyphenyl)methyl]-1-(2-phenylpropan-2-yl)piperidine (PubChem CID 174945032) has the molecular formula C23H31NO2 and a molecular weight of 353.51 g/mol. Its IUPAC name is 3-[(2,4-dimethoxyphenyl)methyl]-1-(2-phenylpropan-2-yl)piperidine.
| Compound Name | 3-[(2,4-dimethoxyphenyl)methyl]-1-(2-phenylpropan-2-yl)piperidine |
|---|---|
| PubChem CID | 174945032 |
| Molecular Formula | C23H31NO2 |
| Molecular Weight | 353.51 g/mol |
| Exact Mass | 353.24 |
| IUPAC Name | 3-[(2,4-dimethoxyphenyl)methyl]-1-(2-phenylpropan-2-yl)piperidine |
| SMILES | COc1ccc(CC2CCCN(C(C)(C)c3ccccc3)C2)c(OC)c1 |
| InChI | InChI=1S/C23H31NO2/c1-23(2,20-10-6-5-7-11-20)24-14-8-9-18(17-24)15-19-12-13-21(25-3)16-22(19)26-4/h5-7,10-13,16,18H,8-9,14-15,17H2,1-4H3 |
| InChIKey | PSRZMHXJLADWMC-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.51 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |