About 1-(3-ethylheptan-3-yl)-1-propylhydrazine;tetradecanoic acid
1-(3-ethylheptan-3-yl)-1-propylhydrazine;tetradecanoic acid (PubChem CID 174950510) has the molecular formula C26H56N2O2
and a molecular weight of 428.75 g/mol. Its IUPAC name is 1-(3-ethylheptan-3-yl)-1-propylhydrazine;tetradecanoic acid.
Molecular Properties
| Compound Name | 1-(3-ethylheptan-3-yl)-1-propylhydrazine;tetradecanoic acid |
| PubChem CID | 174950510 |
| Molecular Formula | C26H56N2O2 |
| Molecular Weight | 428.75 g/mol |
| Exact Mass | 428.43 |
| IUPAC Name | 1-(3-ethylheptan-3-yl)-1-propylhydrazine;tetradecanoic acid |
| SMILES | CCCCC(CC)(CC)N(N)CCC.CCCCCCCCCCCCCC(=O)O |
| InChI | InChI=1S/C14H28O2.C12H28N2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14(15)16;1-5-9-10-12(7-3,8-4)14(13)11-6-2/h2-13H2,1H3,(H,15,16);5-11,13H2,1-4H3 |
| InChIKey | CMCWLCJJIDODQG-UHFFFAOYSA-N |
| XLogP | 8.09 |
| TPSA | 66.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 428.75 |
| LogP ≤ 5 | 8.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-(3-ethylheptan-3-yl)-1-propylhydrazine;tetradecanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3-ethylheptan-3-yl)-1-propylhydrazine;tetradecanoic acid?
The IUPAC name of 1-(3-ethylheptan-3-yl)-1-propylhydrazine;tetradecanoic acid (CID 174950510) is 1-(3-ethylheptan-3-yl)-1-propylhydrazine;tetradecanoic acid.
What is the SMILES notation for 1-(3-ethylheptan-3-yl)-1-propylhydrazine;tetradecanoic acid?
The canonical SMILES for 1-(3-ethylheptan-3-yl)-1-propylhydrazine;tetradecanoic acid is CCCCC(CC)(CC)N(N)CCC.CCCCCCCCCCCCCC(=O)O.
What is the InChIKey of 1-(3-ethylheptan-3-yl)-1-propylhydrazine;tetradecanoic acid?
The InChIKey is CMCWLCJJIDODQG-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H28O2.C12H28N2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14(15)16;1-5-9-10-12(7-3,8-4)14(13)11-6-2/h2-13H2,1H3,(H,15,16);5-11,13H2,1-4H3.
What are the key properties of 1-(3-ethylheptan-3-yl)-1-propylhydrazine;tetradecanoic acid?
1-(3-ethylheptan-3-yl)-1-propylhydrazine;tetradecanoic acid has a molecular weight of 428.75 g/mol, XLogP of 8.09, 20 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3-ethylheptan-3-yl)-1-propylhydrazine;tetradecanoic acid is sourced from PubChem (CID 174950510), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).