About 4-chloro-6-hydroxy-6-(hydroxymethyl)-3-phenylcyclohexa-2,4-diene-1-carboxylic acid
4-chloro-6-hydroxy-6-(hydroxymethyl)-3-phenylcyclohexa-2,4-diene-1-carboxylic acid (PubChem CID 174952429) has the molecular formula C14H13ClO4
and a molecular weight of 280.71 g/mol. Its IUPAC name is 4-chloro-6-hydroxy-6-(hydroxymethyl)-3-phenylcyclohexa-2,4-diene-1-carboxylic acid.
Molecular Properties
| Compound Name | 4-chloro-6-hydroxy-6-(hydroxymethyl)-3-phenylcyclohexa-2,4-diene-1-carboxylic acid |
| PubChem CID | 174952429 |
| Molecular Formula | C14H13ClO4 |
| Molecular Weight | 280.71 g/mol |
| Exact Mass | 280.05 |
| IUPAC Name | 4-chloro-6-hydroxy-6-(hydroxymethyl)-3-phenylcyclohexa-2,4-diene-1-carboxylic acid |
| SMILES | O=C(O)C1C=C(c2ccccc2)C(Cl)=CC1(O)CO |
| InChI | InChI=1S/C14H13ClO4/c15-12-7-14(19,8-16)11(13(17)18)6-10(12)9-4-2-1-3-5-9/h1-7,11,16,19H,8H2,(H,17,18) |
| InChIKey | YQSQXQHINMOQPF-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.71 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-chloro-6-hydroxy-6-(hydroxymethyl)-3-phenylcyclohexa-2,4-diene-1-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloro-6-hydroxy-6-(hydroxymethyl)-3-phenylcyclohexa-2,4-diene-1-carboxylic acid?
The IUPAC name of 4-chloro-6-hydroxy-6-(hydroxymethyl)-3-phenylcyclohexa-2,4-diene-1-carboxylic acid (CID 174952429) is 4-chloro-6-hydroxy-6-(hydroxymethyl)-3-phenylcyclohexa-2,4-diene-1-carboxylic acid.
What is the SMILES notation for 4-chloro-6-hydroxy-6-(hydroxymethyl)-3-phenylcyclohexa-2,4-diene-1-carboxylic acid?
The canonical SMILES for 4-chloro-6-hydroxy-6-(hydroxymethyl)-3-phenylcyclohexa-2,4-diene-1-carboxylic acid is O=C(O)C1C=C(c2ccccc2)C(Cl)=CC1(O)CO.
What is the InChIKey of 4-chloro-6-hydroxy-6-(hydroxymethyl)-3-phenylcyclohexa-2,4-diene-1-carboxylic acid?
The InChIKey is YQSQXQHINMOQPF-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H13ClO4/c15-12-7-14(19,8-16)11(13(17)18)6-10(12)9-4-2-1-3-5-9/h1-7,11,16,19H,8H2,(H,17,18).
What are the key properties of 4-chloro-6-hydroxy-6-(hydroxymethyl)-3-phenylcyclohexa-2,4-diene-1-carboxylic acid?
4-chloro-6-hydroxy-6-(hydroxymethyl)-3-phenylcyclohexa-2,4-diene-1-carboxylic acid has a molecular weight of 280.71 g/mol, XLogP of 1.63, 3 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-6-hydroxy-6-(hydroxymethyl)-3-phenylcyclohexa-2,4-diene-1-carboxylic acid is sourced from PubChem (CID 174952429), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).