About dicalcium;hydrogen arsorate;carbonate
dicalcium;hydrogen arsorate;carbonate (PubChem CID 174953049) has the molecular formula CHAsCa2O7
and a molecular weight of 280.09 g/mol. Its IUPAC name is dicalcium;hydrogen arsorate;carbonate.
Molecular Properties
| Compound Name | dicalcium;hydrogen arsorate;carbonate |
| PubChem CID | 174953049 |
| Molecular Formula | CHAsCa2O7 |
| Molecular Weight | 280.09 g/mol |
| Exact Mass | 279.82 |
| IUPAC Name | dicalcium;hydrogen arsorate;carbonate |
| SMILES | O=C([O-])[O-].O=[As]([O-])([O-])O.[Ca+2].[Ca+2] |
| InChI | InChI=1S/CH2O3.AsH3O4.2Ca/c2-1(3)4;2-1(3,4)5;;/h(H2,2,3,4);(H3,2,3,4,5);;/q;;2*+2/p-4 |
| InChIKey | TVQRYOZPDMTXIA-UHFFFAOYSA-J |
| XLogP | -6.64 |
| TPSA | 146.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.09 |
| LogP ≤ 5 | -6.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze dicalcium;hydrogen arsorate;carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dicalcium;hydrogen arsorate;carbonate?
The IUPAC name of dicalcium;hydrogen arsorate;carbonate (CID 174953049) is dicalcium;hydrogen arsorate;carbonate.
What is the SMILES notation for dicalcium;hydrogen arsorate;carbonate?
The canonical SMILES for dicalcium;hydrogen arsorate;carbonate is O=C([O-])[O-].O=[As]([O-])([O-])O.[Ca+2].[Ca+2].
What is the InChIKey of dicalcium;hydrogen arsorate;carbonate?
The InChIKey is TVQRYOZPDMTXIA-UHFFFAOYSA-J. The full InChI is InChI=1S/CH2O3.AsH3O4.2Ca/c2-1(3)4;2-1(3,4)5;;/h(H2,2,3,4);(H3,2,3,4,5);;/q;;2*+2/p-4.
What are the key properties of dicalcium;hydrogen arsorate;carbonate?
dicalcium;hydrogen arsorate;carbonate has a molecular weight of 280.09 g/mol, XLogP of -6.64, 0 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for dicalcium;hydrogen arsorate;carbonate is sourced from PubChem (CID 174953049), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).