C19H26N2 — CID 174953219
4-N-(4-methylpentan-2-yl)-2-(4-methylphenyl)benzene-1,4-diamine (PubChem CID 174953219) has the molecular formula C19H26N2 and a molecular weight of 282.43 g/mol. Its IUPAC name is 4-N-(4-methylpentan-2-yl)-2-(4-methylphenyl)benzene-1,4-diamine.
| Compound Name | 4-N-(4-methylpentan-2-yl)-2-(4-methylphenyl)benzene-1,4-diamine |
|---|---|
| PubChem CID | 174953219 |
| Molecular Formula | C19H26N2 |
| Molecular Weight | 282.43 g/mol |
| Exact Mass | 282.21 |
| IUPAC Name | 4-N-(4-methylpentan-2-yl)-2-(4-methylphenyl)benzene-1,4-diamine |
| SMILES | Cc1ccc(-c2cc(NC(C)CC(C)C)ccc2N)cc1 |
| InChI | InChI=1S/C19H26N2/c1-13(2)11-15(4)21-17-9-10-19(20)18(12-17)16-7-5-14(3)6-8-16/h5-10,12-13,15,21H,11,20H2,1-4H3 |
| InChIKey | KDEFYQVMJSPTSU-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.43 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|