About 6-(1H-imidazol-5-yl)-3,3-dimethylindole
6-(1H-imidazol-5-yl)-3,3-dimethylindole (PubChem CID 174955710) has the molecular formula C13H13N3
and a molecular weight of 211.27 g/mol. Its IUPAC name is 6-(1H-imidazol-5-yl)-3,3-dimethylindole.
Molecular Properties
| Compound Name | 6-(1H-imidazol-5-yl)-3,3-dimethylindole |
| PubChem CID | 174955710 |
| Molecular Formula | C13H13N3 |
| Molecular Weight | 211.27 g/mol |
| Exact Mass | 211.11 |
| IUPAC Name | 6-(1H-imidazol-5-yl)-3,3-dimethylindole |
| SMILES | CC1(C)C=Nc2cc(-c3cnc[nH]3)ccc21 |
| InChI | InChI=1S/C13H13N3/c1-13(2)7-15-11-5-9(3-4-10(11)13)12-6-14-8-16-12/h3-8H,1-2H3,(H,14,16) |
| InChIKey | PRESJLZSAUYNOK-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 41.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.27 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6-(1H-imidazol-5-yl)-3,3-dimethylindole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(1H-imidazol-5-yl)-3,3-dimethylindole?
The IUPAC name of 6-(1H-imidazol-5-yl)-3,3-dimethylindole (CID 174955710) is 6-(1H-imidazol-5-yl)-3,3-dimethylindole.
What is the SMILES notation for 6-(1H-imidazol-5-yl)-3,3-dimethylindole?
The canonical SMILES for 6-(1H-imidazol-5-yl)-3,3-dimethylindole is CC1(C)C=Nc2cc(-c3cnc[nH]3)ccc21.
What is the InChIKey of 6-(1H-imidazol-5-yl)-3,3-dimethylindole?
The InChIKey is PRESJLZSAUYNOK-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H13N3/c1-13(2)7-15-11-5-9(3-4-10(11)13)12-6-14-8-16-12/h3-8H,1-2H3,(H,14,16).
What are the key properties of 6-(1H-imidazol-5-yl)-3,3-dimethylindole?
6-(1H-imidazol-5-yl)-3,3-dimethylindole has a molecular weight of 211.27 g/mol, XLogP of 3.07, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(1H-imidazol-5-yl)-3,3-dimethylindole is sourced from PubChem (CID 174955710), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).