C7H10N2O2S — CID 174958069
(2,4-diaminophenyl)methanesulfinic acid (PubChem CID 174958069) has the molecular formula C7H10N2O2S and a molecular weight of 186.24 g/mol. Its IUPAC name is (2,4-diaminophenyl)methanesulfinic acid.
| Compound Name | (2,4-diaminophenyl)methanesulfinic acid |
|---|---|
| PubChem CID | 174958069 |
| Molecular Formula | C7H10N2O2S |
| Molecular Weight | 186.24 g/mol |
| Exact Mass | 186.05 |
| IUPAC Name | (2,4-diaminophenyl)methanesulfinic acid |
| SMILES | Nc1ccc(CS(=O)O)c(N)c1 |
| InChI | InChI=1S/C7H10N2O2S/c8-6-2-1-5(4-12(10)11)7(9)3-6/h1-3H,4,8-9H2,(H,10,11) |
| InChIKey | KKLIALNEHWWZTR-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 89.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.24 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|