About ethyl carbonochloridate;oxirane
ethyl carbonochloridate;oxirane (PubChem CID 174958217) has the molecular formula C5H9ClO3
and a molecular weight of 152.58 g/mol. Its IUPAC name is ethyl carbonochloridate;oxirane.
Molecular Properties
| Compound Name | ethyl carbonochloridate;oxirane |
| PubChem CID | 174958217 |
| Molecular Formula | C5H9ClO3 |
| Molecular Weight | 152.58 g/mol |
| Exact Mass | 152.02 |
| IUPAC Name | ethyl carbonochloridate;oxirane |
| SMILES | C1CO1.CCOC(=O)Cl |
| InChI | InChI=1S/C3H5ClO2.C2H4O/c1-2-6-3(4)5;1-2-3-1/h2H2,1H3;1-2H2 |
| InChIKey | HYVDNZIOLPFDHV-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 38.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 152.58 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze ethyl carbonochloridate;oxirane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl carbonochloridate;oxirane?
The IUPAC name of ethyl carbonochloridate;oxirane (CID 174958217) is ethyl carbonochloridate;oxirane.
What is the SMILES notation for ethyl carbonochloridate;oxirane?
The canonical SMILES for ethyl carbonochloridate;oxirane is C1CO1.CCOC(=O)Cl.
What is the InChIKey of ethyl carbonochloridate;oxirane?
The InChIKey is HYVDNZIOLPFDHV-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H5ClO2.C2H4O/c1-2-6-3(4)5;1-2-3-1/h2H2,1H3;1-2H2.
What are the key properties of ethyl carbonochloridate;oxirane?
ethyl carbonochloridate;oxirane has a molecular weight of 152.58 g/mol, XLogP of 1.40, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl carbonochloridate;oxirane is sourced from PubChem (CID 174958217), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).