C8H15NO8S2 — CID 174958379
4-[2,2-bis(methylsulfonyl)ethoxyamino]-4-oxobutanoic acid (PubChem CID 174958379) has the molecular formula C8H15NO8S2 and a molecular weight of 317.34 g/mol. Its IUPAC name is 4-[2,2-bis(methylsulfonyl)ethoxyamino]-4-oxobutanoic acid.
| Compound Name | 4-[2,2-bis(methylsulfonyl)ethoxyamino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 174958379 |
| Molecular Formula | C8H15NO8S2 |
| Molecular Weight | 317.34 g/mol |
| Exact Mass | 317.02 |
| IUPAC Name | 4-[2,2-bis(methylsulfonyl)ethoxyamino]-4-oxobutanoic acid |
| SMILES | CS(=O)(=O)C(CONC(=O)CCC(=O)O)S(C)(=O)=O |
| InChI | InChI=1S/C8H15NO8S2/c1-18(13,14)8(19(2,15)16)5-17-9-6(10)3-4-7(11)12/h8H,3-5H2,1-2H3,(H,9,10)(H,11,12) |
| InChIKey | KIWSPSZEQWKPHL-UHFFFAOYSA-N |
| XLogP | -1.69 |
| TPSA | 143.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.34 |
| LogP ≤ 5 | -1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|