C11H17N3O6S — CID 87993725
4-[[3-(2-cyanoethylamino)-2-methylsulfonyl-3-oxopropyl]amino]-4-oxobutanoic acid (PubChem CID 87993725) has the molecular formula C11H17N3O6S and a molecular weight of 319.34 g/mol. Its IUPAC name is 4-[[3-(2-cyanoethylamino)-2-methylsulfonyl-3-oxopropyl]amino]-4-oxobutanoic acid.
| Compound Name | 4-[[3-(2-cyanoethylamino)-2-methylsulfonyl-3-oxopropyl]amino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 87993725 |
| Molecular Formula | C11H17N3O6S |
| Molecular Weight | 319.34 g/mol |
| Exact Mass | 319.08 |
| IUPAC Name | 4-[[3-(2-cyanoethylamino)-2-methylsulfonyl-3-oxopropyl]amino]-4-oxobutanoic acid |
| SMILES | CS(=O)(=O)C(CNC(=O)CCC(=O)O)C(=O)NCCC#N |
| InChI | InChI=1S/C11H17N3O6S/c1-21(19,20)8(11(18)13-6-2-5-12)7-14-9(15)3-4-10(16)17/h8H,2-4,6-7H2,1H3,(H,13,18)(H,14,15)(H,16,17) |
| InChIKey | MWDMKFCQNMUFMF-UHFFFAOYSA-N |
| XLogP | -1.59 |
| TPSA | 153.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.34 |
| LogP ≤ 5 | -1.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|