C17H15Zr- — CID 174959119
3-(3,5-dimethylphenyl)-1H-inden-1-ide;zirconium (PubChem CID 174959119) has the molecular formula C17H15Zr- and a molecular weight of 310.53 g/mol. Its IUPAC name is 3-(3,5-dimethylphenyl)-1H-inden-1-ide;zirconium.
| Compound Name | 3-(3,5-dimethylphenyl)-1H-inden-1-ide;zirconium |
|---|---|
| PubChem CID | 174959119 |
| Molecular Formula | C17H15Zr- |
| Molecular Weight | 310.53 g/mol |
| Exact Mass | 309.02 |
| IUPAC Name | 3-(3,5-dimethylphenyl)-1H-inden-1-ide;zirconium |
| SMILES | Cc1cc(C)cc(-c2c[cH-]c3ccccc23)c1.[Zr] |
| InChI | InChI=1S/C17H15.Zr/c1-12-9-13(2)11-15(10-12)17-8-7-14-5-3-4-6-16(14)17;/h3-11H,1-2H3;/q-1; |
| InChIKey | OLDJCYPHHKQZSX-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.53 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|