About hafnium;3-methyl-1H-inden-1-ide;dichloride
hafnium;3-methyl-1H-inden-1-ide;dichloride (PubChem CID 89420354) has the molecular formula C10H9Cl2Hf-3
and a molecular weight of 378.58 g/mol. Its IUPAC name is hafnium;3-methyl-1H-inden-1-ide;dichloride.
Molecular Properties
| Compound Name | hafnium;3-methyl-1H-inden-1-ide;dichloride |
| PubChem CID | 89420354 |
| Molecular Formula | C10H9Cl2Hf-3 |
| Molecular Weight | 378.58 g/mol |
| Exact Mass | 378.96 |
| IUPAC Name | hafnium;3-methyl-1H-inden-1-ide;dichloride |
| SMILES | Cc1c[cH-]c2ccccc12.[Cl-].[Cl-].[Hf] |
| InChI | InChI=1S/C10H9.2ClH.Hf/c1-8-6-7-9-4-2-3-5-10(8)9;;;/h2-7H,1H3;2*1H;/q-1;;;/p-2 |
| InChIKey | KYNOXEIWUGWJAQ-UHFFFAOYSA-L |
| XLogP | -3.13 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 378.58 |
| LogP ≤ 5 | -3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze hafnium;3-methyl-1H-inden-1-ide;dichloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hafnium;3-methyl-1H-inden-1-ide;dichloride?
The IUPAC name of hafnium;3-methyl-1H-inden-1-ide;dichloride (CID 89420354) is hafnium;3-methyl-1H-inden-1-ide;dichloride.
What is the SMILES notation for hafnium;3-methyl-1H-inden-1-ide;dichloride?
The canonical SMILES for hafnium;3-methyl-1H-inden-1-ide;dichloride is Cc1c[cH-]c2ccccc12.[Cl-].[Cl-].[Hf].
What is the InChIKey of hafnium;3-methyl-1H-inden-1-ide;dichloride?
The InChIKey is KYNOXEIWUGWJAQ-UHFFFAOYSA-L. The full InChI is InChI=1S/C10H9.2ClH.Hf/c1-8-6-7-9-4-2-3-5-10(8)9;;;/h2-7H,1H3;2*1H;/q-1;;;/p-2.
What are the key properties of hafnium;3-methyl-1H-inden-1-ide;dichloride?
hafnium;3-methyl-1H-inden-1-ide;dichloride has a molecular weight of 378.58 g/mol, XLogP of -3.13, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for hafnium;3-methyl-1H-inden-1-ide;dichloride is sourced from PubChem (CID 89420354), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).