About 3-benzyl-1H-inden-1-ide;hafnium;dichloride
3-benzyl-1H-inden-1-ide;hafnium;dichloride (PubChem CID 87620240) has the molecular formula C16H13Cl2Hf-3
and a molecular weight of 454.68 g/mol. Its IUPAC name is 3-benzyl-1H-inden-1-ide;hafnium;dichloride.
Molecular Properties
| Compound Name | 3-benzyl-1H-inden-1-ide;hafnium;dichloride |
| PubChem CID | 87620240 |
| Molecular Formula | C16H13Cl2Hf-3 |
| Molecular Weight | 454.68 g/mol |
| Exact Mass | 454.99 |
| IUPAC Name | 3-benzyl-1H-inden-1-ide;hafnium;dichloride |
| SMILES | [Cl-].[Cl-].[Hf].c1ccc(Cc2c[cH-]c3ccccc23)cc1 |
| InChI | InChI=1S/C16H13.2ClH.Hf/c1-2-6-13(7-3-1)12-15-11-10-14-8-4-5-9-16(14)15;;;/h1-11H,12H2;2*1H;/q-1;;;/p-2 |
| InChIKey | QZOPTIKPYLCFHP-UHFFFAOYSA-L |
| XLogP | -1.85 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 454.68 |
| LogP ≤ 5 | -1.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 3-benzyl-1H-inden-1-ide;hafnium;dichloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-benzyl-1H-inden-1-ide;hafnium;dichloride?
The IUPAC name of 3-benzyl-1H-inden-1-ide;hafnium;dichloride (CID 87620240) is 3-benzyl-1H-inden-1-ide;hafnium;dichloride.
What is the SMILES notation for 3-benzyl-1H-inden-1-ide;hafnium;dichloride?
The canonical SMILES for 3-benzyl-1H-inden-1-ide;hafnium;dichloride is [Cl-].[Cl-].[Hf].c1ccc(Cc2c[cH-]c3ccccc23)cc1.
What is the InChIKey of 3-benzyl-1H-inden-1-ide;hafnium;dichloride?
The InChIKey is QZOPTIKPYLCFHP-UHFFFAOYSA-L. The full InChI is InChI=1S/C16H13.2ClH.Hf/c1-2-6-13(7-3-1)12-15-11-10-14-8-4-5-9-16(14)15;;;/h1-11H,12H2;2*1H;/q-1;;;/p-2.
What are the key properties of 3-benzyl-1H-inden-1-ide;hafnium;dichloride?
3-benzyl-1H-inden-1-ide;hafnium;dichloride has a molecular weight of 454.68 g/mol, XLogP of -1.85, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 3-benzyl-1H-inden-1-ide;hafnium;dichloride is sourced from PubChem (CID 87620240), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).