C24H20N4O3 — CID 17496046
N'-[3-(2-hydroxyphenyl)propanoyl]-2-pyridin-3-ylquinoline-4-carbohydrazide (PubChem CID 17496046) has the molecular formula C24H20N4O3 and a molecular weight of 412.45 g/mol. Its IUPAC name is N'-[3-(2-hydroxyphenyl)propanoyl]-2-pyridin-3-ylquinoline-4-carbohydrazide.
| Compound Name | N'-[3-(2-hydroxyphenyl)propanoyl]-2-pyridin-3-ylquinoline-4-carbohydrazide |
|---|---|
| PubChem CID | 17496046 |
| Molecular Formula | C24H20N4O3 |
| Molecular Weight | 412.45 g/mol |
| Exact Mass | 412.15 |
| IUPAC Name | N'-[3-(2-hydroxyphenyl)propanoyl]-2-pyridin-3-ylquinoline-4-carbohydrazide |
| SMILES | O=C(CCc1ccccc1O)NNC(=O)c1cc(-c2cccnc2)nc2ccccc12 |
| InChI | InChI=1S/C24H20N4O3/c29-22-10-4-1-6-16(22)11-12-23(30)27-28-24(31)19-14-21(17-7-5-13-25-15-17)26-20-9-3-2-8-18(19)20/h1-10,13-15,29H,11-12H2,(H,27,30)(H,28,31) |
| InChIKey | GYRLTURWALXDBM-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 104.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.45 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|