C28H28N6O2 — CID 27670101
N'-[3-(4-phenylpiperazin-1-yl)propanoyl]-2-pyridin-3-ylquinoline-4-carbohydrazide (PubChem CID 27670101) has the molecular formula C28H28N6O2 and a molecular weight of 480.57 g/mol. Its IUPAC name is N'-[3-(4-phenylpiperazin-1-yl)propanoyl]-2-pyridin-3-ylquinoline-4-carbohydrazide.
| Compound Name | N'-[3-(4-phenylpiperazin-1-yl)propanoyl]-2-pyridin-3-ylquinoline-4-carbohydrazide |
|---|---|
| PubChem CID | 27670101 |
| Molecular Formula | C28H28N6O2 |
| Molecular Weight | 480.57 g/mol |
| Exact Mass | 480.23 |
| IUPAC Name | N'-[3-(4-phenylpiperazin-1-yl)propanoyl]-2-pyridin-3-ylquinoline-4-carbohydrazide |
| SMILES | O=C(CCN1CCN(c2ccccc2)CC1)NNC(=O)c1cc(-c2cccnc2)nc2ccccc12 |
| InChI | InChI=1S/C28H28N6O2/c35-27(12-14-33-15-17-34(18-16-33)22-8-2-1-3-9-22)31-32-28(36)24-19-26(21-7-6-13-29-20-21)30-25-11-5-4-10-23(24)25/h1-11,13,19-20H,12,14-18H2,(H,31,35)(H,32,36) |
| InChIKey | OUCXSOJNGFHCNS-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 90.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.57 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|