About (2-amino-5-nitrophenyl) formate
(2-amino-5-nitrophenyl) formate (PubChem CID 174961897) has the molecular formula C7H6N2O4
and a molecular weight of 182.14 g/mol. Its IUPAC name is (2-amino-5-nitrophenyl) formate.
Molecular Properties
| Compound Name | (2-amino-5-nitrophenyl) formate |
| PubChem CID | 174961897 |
| Molecular Formula | C7H6N2O4 |
| Molecular Weight | 182.14 g/mol |
| Exact Mass | 182.03 |
| IUPAC Name | (2-amino-5-nitrophenyl) formate |
| SMILES | Nc1ccc([N+](=O)[O-])cc1OC=O |
| InChI | InChI=1S/C7H6N2O4/c8-6-2-1-5(9(11)12)3-7(6)13-4-10/h1-4H,8H2 |
| InChIKey | RDWLJPCPFABHDN-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 95.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.14 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (2-amino-5-nitrophenyl) formate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-amino-5-nitrophenyl) formate?
The IUPAC name of (2-amino-5-nitrophenyl) formate (CID 174961897) is (2-amino-5-nitrophenyl) formate.
What is the SMILES notation for (2-amino-5-nitrophenyl) formate?
The canonical SMILES for (2-amino-5-nitrophenyl) formate is Nc1ccc([N+](=O)[O-])cc1OC=O.
What is the InChIKey of (2-amino-5-nitrophenyl) formate?
The InChIKey is RDWLJPCPFABHDN-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6N2O4/c8-6-2-1-5(9(11)12)3-7(6)13-4-10/h1-4H,8H2.
What are the key properties of (2-amino-5-nitrophenyl) formate?
(2-amino-5-nitrophenyl) formate has a molecular weight of 182.14 g/mol, XLogP of 0.71, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2-amino-5-nitrophenyl) formate is sourced from PubChem (CID 174961897), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).