About bicyclo[3.1.0]hexane;2-oxopropanoic acid
bicyclo[3.1.0]hexane;2-oxopropanoic acid (PubChem CID 174962132) has the molecular formula C9H14O3
and a molecular weight of 170.21 g/mol. Its IUPAC name is bicyclo[3.1.0]hexane;2-oxopropanoic acid.
Molecular Properties
| Compound Name | bicyclo[3.1.0]hexane;2-oxopropanoic acid |
| PubChem CID | 174962132 |
| Molecular Formula | C9H14O3 |
| Molecular Weight | 170.21 g/mol |
| Exact Mass | 170.09 |
| IUPAC Name | bicyclo[3.1.0]hexane;2-oxopropanoic acid |
| SMILES | C1CC2CC2C1.CC(=O)C(=O)O |
| InChI | InChI=1S/C6H10.C3H4O3/c1-2-5-4-6(5)3-1;1-2(4)3(5)6/h5-6H,1-4H2;1H3,(H,5,6) |
| InChIKey | FAIGBTZSQAOJNE-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.21 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze bicyclo[3.1.0]hexane;2-oxopropanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bicyclo[3.1.0]hexane;2-oxopropanoic acid?
The IUPAC name of bicyclo[3.1.0]hexane;2-oxopropanoic acid (CID 174962132) is bicyclo[3.1.0]hexane;2-oxopropanoic acid.
What is the SMILES notation for bicyclo[3.1.0]hexane;2-oxopropanoic acid?
The canonical SMILES for bicyclo[3.1.0]hexane;2-oxopropanoic acid is C1CC2CC2C1.CC(=O)C(=O)O.
What is the InChIKey of bicyclo[3.1.0]hexane;2-oxopropanoic acid?
The InChIKey is FAIGBTZSQAOJNE-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10.C3H4O3/c1-2-5-4-6(5)3-1;1-2(4)3(5)6/h5-6H,1-4H2;1H3,(H,5,6).
What are the key properties of bicyclo[3.1.0]hexane;2-oxopropanoic acid?
bicyclo[3.1.0]hexane;2-oxopropanoic acid has a molecular weight of 170.21 g/mol, XLogP of 1.47, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for bicyclo[3.1.0]hexane;2-oxopropanoic acid is sourced from PubChem (CID 174962132), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).