C10H14O3 — CID 164990129
2-[(3aR,6aS)-1,2,3,3a,4,5,6,6a-octahydropentalen-2-yl]-2-oxoacetic acid (PubChem CID 164990129) has the molecular formula C10H14O3 and a molecular weight of 182.22 g/mol. Its IUPAC name is 2-[(3aR,6aS)-1,2,3,3a,4,5,6,6a-octahydropentalen-2-yl]-2-oxoacetic acid.
| Compound Name | 2-[(3aR,6aS)-1,2,3,3a,4,5,6,6a-octahydropentalen-2-yl]-2-oxoacetic acid |
|---|---|
| PubChem CID | 164990129 |
| Molecular Formula | C10H14O3 |
| Molecular Weight | 182.22 g/mol |
| Exact Mass | 182.09 |
| IUPAC Name | 2-[(3aR,6aS)-1,2,3,3a,4,5,6,6a-octahydropentalen-2-yl]-2-oxoacetic acid |
| SMILES | O=C(O)C(=O)C1C[C@H]2CCC[C@H]2C1 |
| InChI | InChI=1S/C10H14O3/c11-9(10(12)13)8-4-6-2-1-3-7(6)5-8/h6-8H,1-5H2,(H,12,13)/t6-,7+,8? |
| InChIKey | CFPXHOYWSZWUDH-DHBOJHSNSA-N |
| XLogP | 1.47 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.22 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|