C20H32O2 — CID 90830830
1-(1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl)-2-(3,5-dimethylcyclohexyl)ethane-1,2-dione (PubChem CID 90830830) has the molecular formula C20H32O2 and a molecular weight of 304.47 g/mol. Its IUPAC name is 1-(1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl)-2-(3,5-dimethylcyclohexyl)ethane-1,2-dione.
| Compound Name | 1-(1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl)-2-(3,5-dimethylcyclohexyl)ethane-1,2-dione |
|---|---|
| PubChem CID | 90830830 |
| Molecular Formula | C20H32O2 |
| Molecular Weight | 304.47 g/mol |
| Exact Mass | 304.24 |
| IUPAC Name | 1-(1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl)-2-(3,5-dimethylcyclohexyl)ethane-1,2-dione |
| SMILES | CC1CC(C)CC(C(=O)C(=O)C2CCC3CCCCC3C2)C1 |
| InChI | InChI=1S/C20H32O2/c1-13-9-14(2)11-18(10-13)20(22)19(21)17-8-7-15-5-3-4-6-16(15)12-17/h13-18H,3-12H2,1-2H3 |
| InChIKey | UNSWJNYQTVGSGW-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.47 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|