C18H28F2N2O3 — CID 174964583
3-[3-(difluoromethoxy)-4-(4-methylpiperazin-1-yl)phenoxy]-2,3-dimethylbutan-2-ol (PubChem CID 174964583) has the molecular formula C18H28F2N2O3 and a molecular weight of 358.43 g/mol. Its IUPAC name is 3-[3-(difluoromethoxy)-4-(4-methylpiperazin-1-yl)phenoxy]-2,3-dimethylbutan-2-ol.
| Compound Name | 3-[3-(difluoromethoxy)-4-(4-methylpiperazin-1-yl)phenoxy]-2,3-dimethylbutan-2-ol |
|---|---|
| PubChem CID | 174964583 |
| Molecular Formula | C18H28F2N2O3 |
| Molecular Weight | 358.43 g/mol |
| Exact Mass | 358.21 |
| IUPAC Name | 3-[3-(difluoromethoxy)-4-(4-methylpiperazin-1-yl)phenoxy]-2,3-dimethylbutan-2-ol |
| SMILES | CN1CCN(c2ccc(OC(C)(C)C(C)(C)O)cc2OC(F)F)CC1 |
| InChI | InChI=1S/C18H28F2N2O3/c1-17(2,23)18(3,4)25-13-6-7-14(15(12-13)24-16(19)20)22-10-8-21(5)9-11-22/h6-7,12,16,23H,8-11H2,1-5H3 |
| InChIKey | PWYNVGKXXCNMDX-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 45.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.43 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|