C13H17IN2 — CID 174965029
2-(tert-butylamino)-3-(4-iodophenyl)propanenitrile (PubChem CID 174965029) has the molecular formula C13H17IN2 and a molecular weight of 328.20 g/mol. Its IUPAC name is 2-(tert-butylamino)-3-(4-iodophenyl)propanenitrile.
| Compound Name | 2-(tert-butylamino)-3-(4-iodophenyl)propanenitrile |
|---|---|
| PubChem CID | 174965029 |
| Molecular Formula | C13H17IN2 |
| Molecular Weight | 328.20 g/mol |
| Exact Mass | 328.04 |
| IUPAC Name | 2-(tert-butylamino)-3-(4-iodophenyl)propanenitrile |
| SMILES | CC(C)(C)NC(C#N)Cc1ccc(I)cc1 |
| InChI | InChI=1S/C13H17IN2/c1-13(2,3)16-12(9-15)8-10-4-6-11(14)7-5-10/h4-7,12,16H,8H2,1-3H3 |
| InChIKey | CSEPBKTUJAPSQP-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.20 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|