About nitrosulfanylmethylbenzene;phosphoric acid;trihydrate
nitrosulfanylmethylbenzene;phosphoric acid;trihydrate (PubChem CID 174965770) has the molecular formula C7H19NO13P2S
and a molecular weight of 419.24 g/mol. Its IUPAC name is nitrosulfanylmethylbenzene;phosphoric acid;trihydrate.
Molecular Properties
| Compound Name | nitrosulfanylmethylbenzene;phosphoric acid;trihydrate |
| PubChem CID | 174965770 |
| Molecular Formula | C7H19NO13P2S |
| Molecular Weight | 419.24 g/mol |
| Exact Mass | 419.01 |
| IUPAC Name | nitrosulfanylmethylbenzene;phosphoric acid;trihydrate |
| SMILES | O.O.O.O=P(O)(O)O.O=P(O)(O)O.O=[N+]([O-])SCc1ccccc1 |
| InChI | InChI=1S/C7H7NO2S.2H3O4P.3H2O/c9-8(10)11-6-7-4-2-1-3-5-7;2*1-5(2,3)4;;;/h1-5H,6H2;2*(H3,1,2,3,4);3*1H2 |
| InChIKey | BMCLOPCOSUFNSC-UHFFFAOYSA-N |
| XLogP | -2.22 |
| TPSA | 293.16 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 419.24 |
| LogP ≤ 5 | -2.22 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze nitrosulfanylmethylbenzene;phosphoric acid;trihydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of nitrosulfanylmethylbenzene;phosphoric acid;trihydrate?
The IUPAC name of nitrosulfanylmethylbenzene;phosphoric acid;trihydrate (CID 174965770) is nitrosulfanylmethylbenzene;phosphoric acid;trihydrate.
What is the SMILES notation for nitrosulfanylmethylbenzene;phosphoric acid;trihydrate?
The canonical SMILES for nitrosulfanylmethylbenzene;phosphoric acid;trihydrate is O.O.O.O=P(O)(O)O.O=P(O)(O)O.O=[N+]([O-])SCc1ccccc1.
What is the InChIKey of nitrosulfanylmethylbenzene;phosphoric acid;trihydrate?
The InChIKey is BMCLOPCOSUFNSC-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7NO2S.2H3O4P.3H2O/c9-8(10)11-6-7-4-2-1-3-5-7;2*1-5(2,3)4;;;/h1-5H,6H2;2*(H3,1,2,3,4);3*1H2.
What are the key properties of nitrosulfanylmethylbenzene;phosphoric acid;trihydrate?
nitrosulfanylmethylbenzene;phosphoric acid;trihydrate has a molecular weight of 419.24 g/mol, XLogP of -2.22, 3 rotatable bonds, 6 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for nitrosulfanylmethylbenzene;phosphoric acid;trihydrate is sourced from PubChem (CID 174965770), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).