C10H18N2 — CID 174965958
5-butyl-N,N-dimethyl-1H-pyrrol-3-amine (PubChem CID 174965958) has the molecular formula C10H18N2 and a molecular weight of 166.27 g/mol. Its IUPAC name is 5-butyl-N,N-dimethyl-1H-pyrrol-3-amine.
| Compound Name | 5-butyl-N,N-dimethyl-1H-pyrrol-3-amine |
|---|---|
| PubChem CID | 174965958 |
| Molecular Formula | C10H18N2 |
| Molecular Weight | 166.27 g/mol |
| Exact Mass | 166.15 |
| IUPAC Name | 5-butyl-N,N-dimethyl-1H-pyrrol-3-amine |
| SMILES | CCCCc1cc(N(C)C)c[nH]1 |
| InChI | InChI=1S/C10H18N2/c1-4-5-6-9-7-10(8-11-9)12(2)3/h7-8,11H,4-6H2,1-3H3 |
| InChIKey | BHHZRXNPXAVSOO-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 19.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.27 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |